C15H22N2O6 — CID 171156320
2-(4-methoxyphenyl)-2-morpholin-4-ylethanamine;oxalic acid (PubChem CID 171156320) has the molecular formula C15H22N2O6 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-2-morpholin-4-ylethanamine;oxalic acid.
| Compound Name | 2-(4-methoxyphenyl)-2-morpholin-4-ylethanamine;oxalic acid |
|---|---|
| PubChem CID | 171156320 |
| Molecular Formula | C15H22N2O6 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-(4-methoxyphenyl)-2-morpholin-4-ylethanamine;oxalic acid |
| SMILES | COc1ccc(C(CN)N2CCOCC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H20N2O2.C2H2O4/c1-16-12-4-2-11(3-5-12)13(10-14)15-6-8-17-9-7-15;3-1(4)2(5)6/h2-5,13H,6-10,14H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | APUPWNYDIJMRID-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|