C13H20N2O3S — CID 43581263
2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(4-methoxyphenyl)ethanamine (PubChem CID 43581263) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(4-methoxyphenyl)ethanamine.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(4-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 43581263 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(4-methoxyphenyl)ethanamine |
| SMILES | COc1ccc(C(CN)N2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C13H20N2O3S/c1-18-12-4-2-11(3-5-12)13(10-14)15-6-8-19(16,17)9-7-15/h2-5,13H,6-10,14H2,1H3 |
| InChIKey | HUXAXQXJWFYOKR-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |