C27H31ClN2O4S — CID 98390779
N-[4-[(5R,7R)-3-chloro-1-adamantyl]phenyl]-4-morpholin-4-ylsulfonylbenzamide (PubChem CID 98390779) has the molecular formula C27H31ClN2O4S and a molecular weight of 515.08 g/mol. Its IUPAC name is N-[4-[(5R,7R)-3-chloro-1-adamantyl]phenyl]-4-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[4-[(5R,7R)-3-chloro-1-adamantyl]phenyl]-4-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 98390779 |
| Molecular Formula | C27H31ClN2O4S |
| Molecular Weight | 515.08 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | N-[4-[(5R,7R)-3-chloro-1-adamantyl]phenyl]-4-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(Nc1ccc(C23C[C@H]4C[C@@H](CC(Cl)(C4)C2)C3)cc1)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C27H31ClN2O4S/c28-27-16-19-13-20(17-27)15-26(14-19,18-27)22-3-5-23(6-4-22)29-25(31)21-1-7-24(8-2-21)35(32,33)30-9-11-34-12-10-30/h1-8,19-20H,9-18H2,(H,29,31)/t19-,20-,26?,27?/m1/s1 |
| InChIKey | MHGMKPAFDFZZAP-KDGKYOGISA-N |
| XLogP | 4.79 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.08 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|