C29H29N3O3 — CID 155134030
6-[4-[[4-(1-adamantyl)phenyl]carbamoyl]anilino]pyridine-2-carboxylic acid (PubChem CID 155134030) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 6-[4-[[4-(1-adamantyl)phenyl]carbamoyl]anilino]pyridine-2-carboxylic acid.
| Compound Name | 6-[4-[[4-(1-adamantyl)phenyl]carbamoyl]anilino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 155134030 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 6-[4-[[4-(1-adamantyl)phenyl]carbamoyl]anilino]pyridine-2-carboxylic acid |
| SMILES | O=C(Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1)c1ccc(Nc2cccc(C(=O)O)n2)cc1 |
| InChI | InChI=1S/C29H29N3O3/c33-27(21-4-8-23(9-5-21)30-26-3-1-2-25(32-26)28(34)35)31-24-10-6-22(7-11-24)29-15-18-12-19(16-29)14-20(13-18)17-29/h1-11,18-20H,12-17H2,(H,30,32)(H,31,33)(H,34,35) |
| InChIKey | QFTPPRPLTVDNFN-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |