C30H30N2O4 — CID 155134704
methyl 6-[4-[[4-(1-adamantyl)phenyl]carbamoyl]phenoxy]pyridine-2-carboxylate (PubChem CID 155134704) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is methyl 6-[4-[[4-(1-adamantyl)phenyl]carbamoyl]phenoxy]pyridine-2-carboxylate.
| Compound Name | methyl 6-[4-[[4-(1-adamantyl)phenyl]carbamoyl]phenoxy]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 155134704 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | methyl 6-[4-[[4-(1-adamantyl)phenyl]carbamoyl]phenoxy]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(Oc2ccc(C(=O)Nc3ccc(C45CC6CC(CC(C6)C4)C5)cc3)cc2)n1 |
| InChI | InChI=1S/C30H30N2O4/c1-35-29(34)26-3-2-4-27(32-26)36-25-11-5-22(6-12-25)28(33)31-24-9-7-23(8-10-24)30-16-19-13-20(17-30)15-21(14-19)18-30/h2-12,19-21H,13-18H2,1H3,(H,31,33) |
| InChIKey | XZHVLWXEIROHKH-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |