C32H34N2O3 — CID 10601277
methyl 4-[[2-[4-(1-adamantyl)-N-methylanilino]phenyl]carbamoyl]benzoate (PubChem CID 10601277) has the molecular formula C32H34N2O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is methyl 4-[[2-[4-(1-adamantyl)-N-methylanilino]phenyl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[2-[4-(1-adamantyl)-N-methylanilino]phenyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 10601277 |
| Molecular Formula | C32H34N2O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | methyl 4-[[2-[4-(1-adamantyl)-N-methylanilino]phenyl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2ccccc2N(C)c2ccc(C34CC5CC(CC(C5)C3)C4)cc2)cc1 |
| InChI | InChI=1S/C32H34N2O3/c1-34(27-13-11-26(12-14-27)32-18-21-15-22(19-32)17-23(16-21)20-32)29-6-4-3-5-28(29)33-30(35)24-7-9-25(10-8-24)31(36)37-2/h3-14,21-23H,15-20H2,1-2H3,(H,33,35) |
| InChIKey | UFEAKOMBYQPLNG-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |