C35H41N3O4 — CID 155133737
methyl 2-[4-[4-(1-adamantyl)-N-methylanilino]anilino]-4-(3-methoxypropanoylamino)benzoate (PubChem CID 155133737) has the molecular formula C35H41N3O4 and a molecular weight of 567.73 g/mol. Its IUPAC name is methyl 2-[4-[4-(1-adamantyl)-N-methylanilino]anilino]-4-(3-methoxypropanoylamino)benzoate.
| Compound Name | methyl 2-[4-[4-(1-adamantyl)-N-methylanilino]anilino]-4-(3-methoxypropanoylamino)benzoate |
|---|---|
| PubChem CID | 155133737 |
| Molecular Formula | C35H41N3O4 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.31 |
| IUPAC Name | methyl 2-[4-[4-(1-adamantyl)-N-methylanilino]anilino]-4-(3-methoxypropanoylamino)benzoate |
| SMILES | COCCC(=O)Nc1ccc(C(=O)OC)c(Nc2ccc(N(C)c3ccc(C45CC6CC(CC(C6)C4)C5)cc3)cc2)c1 |
| InChI | InChI=1S/C35H41N3O4/c1-38(29-9-4-26(5-10-29)35-20-23-16-24(21-35)18-25(17-23)22-35)30-11-6-27(7-12-30)36-32-19-28(37-33(39)14-15-41-2)8-13-31(32)34(40)42-3/h4-13,19,23-25,36H,14-18,20-22H2,1-3H3,(H,37,39) |
| InChIKey | JWQBXZDTBGQGFH-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |