C30H32N2O3 — CID 155134122
2-[4-[4-(1-adamantyl)anilino]anilino]-4-methoxybenzoic acid (PubChem CID 155134122) has the molecular formula C30H32N2O3 and a molecular weight of 468.60 g/mol. Its IUPAC name is 2-[4-[4-(1-adamantyl)anilino]anilino]-4-methoxybenzoic acid.
| Compound Name | 2-[4-[4-(1-adamantyl)anilino]anilino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 155134122 |
| Molecular Formula | C30H32N2O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 2-[4-[4-(1-adamantyl)anilino]anilino]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)c(Nc2ccc(Nc3ccc(C45CC6CC(CC(C6)C4)C5)cc3)cc2)c1 |
| InChI | InChI=1S/C30H32N2O3/c1-35-26-10-11-27(29(33)34)28(15-26)32-25-8-6-24(7-9-25)31-23-4-2-22(3-5-23)30-16-19-12-20(17-30)14-21(13-19)18-30/h2-11,15,19-21,31-32H,12-14,16-18H2,1H3,(H,33,34) |
| InChIKey | OYUHEBWNWDWGRF-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |