C29H30N2O2 — CID 155133571
2-[3-[4-(1-adamantyl)anilino]anilino]benzoic acid (PubChem CID 155133571) has the molecular formula C29H30N2O2 and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-[3-[4-(1-adamantyl)anilino]anilino]benzoic acid.
| Compound Name | 2-[3-[4-(1-adamantyl)anilino]anilino]benzoic acid |
|---|---|
| PubChem CID | 155133571 |
| Molecular Formula | C29H30N2O2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 2-[3-[4-(1-adamantyl)anilino]anilino]benzoic acid |
| SMILES | O=C(O)c1ccccc1Nc1cccc(Nc2ccc(C34CC5CC(CC(C5)C3)C4)cc2)c1 |
| InChI | InChI=1S/C29H30N2O2/c32-28(33)26-6-1-2-7-27(26)31-25-5-3-4-24(15-25)30-23-10-8-22(9-11-23)29-16-19-12-20(17-29)14-21(13-19)18-29/h1-11,15,19-21,30-31H,12-14,16-18H2,(H,32,33) |
| InChIKey | VJBHOFUDKQALCL-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |