C30H31N3O3 — CID 155134582
methyl 2-[[4-[4-(1-adamantyl)anilino]benzoyl]amino]pyridine-3-carboxylate (PubChem CID 155134582) has the molecular formula C30H31N3O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is methyl 2-[[4-[4-(1-adamantyl)anilino]benzoyl]amino]pyridine-3-carboxylate.
| Compound Name | methyl 2-[[4-[4-(1-adamantyl)anilino]benzoyl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 155134582 |
| Molecular Formula | C30H31N3O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | methyl 2-[[4-[4-(1-adamantyl)anilino]benzoyl]amino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1NC(=O)c1ccc(Nc2ccc(C34CC5CC(CC(C5)C3)C4)cc2)cc1 |
| InChI | InChI=1S/C30H31N3O3/c1-36-29(35)26-3-2-12-31-27(26)33-28(34)22-4-8-24(9-5-22)32-25-10-6-23(7-11-25)30-16-19-13-20(17-30)15-21(14-19)18-30/h2-12,19-21,32H,13-18H2,1H3,(H,31,33,34) |
| InChIKey | HJVMGDHLRNNTGE-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |