C30H30ClN3O3 — CID 155133693
methyl 2-[3-[[4-(1-adamantyl)-2-chlorophenyl]carbamoyl]anilino]pyridine-3-carboxylate (PubChem CID 155133693) has the molecular formula C30H30ClN3O3 and a molecular weight of 516.04 g/mol. Its IUPAC name is methyl 2-[3-[[4-(1-adamantyl)-2-chlorophenyl]carbamoyl]anilino]pyridine-3-carboxylate.
| Compound Name | methyl 2-[3-[[4-(1-adamantyl)-2-chlorophenyl]carbamoyl]anilino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 155133693 |
| Molecular Formula | C30H30ClN3O3 |
| Molecular Weight | 516.04 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | methyl 2-[3-[[4-(1-adamantyl)-2-chlorophenyl]carbamoyl]anilino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1Nc1cccc(C(=O)Nc2ccc(C34CC5CC(CC(C5)C3)C4)cc2Cl)c1 |
| InChI | InChI=1S/C30H30ClN3O3/c1-37-29(36)24-6-3-9-32-27(24)33-23-5-2-4-21(13-23)28(35)34-26-8-7-22(14-25(26)31)30-15-18-10-19(16-30)12-20(11-18)17-30/h2-9,13-14,18-20H,10-12,15-17H2,1H3,(H,32,33)(H,34,35) |
| InChIKey | QDUDVALJPRAZIV-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.04 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |