About 2-[4-[[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]carbamoyl]phenoxy]benzoic acid
2-[4-[[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]carbamoyl]phenoxy]benzoic acid (PubChem CID 155697042) has the molecular formula C31H33NO4
and a molecular weight of 483.61 g/mol. Its IUPAC name is 2-[4-[[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]carbamoyl]phenoxy]benzoic acid.
Molecular Properties
| Compound Name | 2-[4-[[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]carbamoyl]phenoxy]benzoic acid |
| PubChem CID | 155697042 |
| Molecular Formula | C31H33NO4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 2-[4-[[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]carbamoyl]phenoxy]benzoic acid |
| SMILES | CC1CC2CC(C1)CC(C)(c1ccc(NC(=O)c3ccc(Oc4ccccc4C(=O)O)cc3)cc1)C2 |
| InChI | InChI=1S/C31H33NO4/c1-20-15-21-17-22(16-20)19-31(2,18-21)24-9-11-25(12-10-24)32-29(33)23-7-13-26(14-8-23)36-28-6-4-3-5-27(28)30(34)35/h3-14,20-22H,15-19H2,1-2H3,(H,32,33)(H,34,35) |
| InChIKey | ZOUCBDJRENUFIU-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-[[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]carbamoyl]phenoxy]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]carbamoyl]phenoxy]benzoic acid?
The IUPAC name of 2-[4-[[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]carbamoyl]phenoxy]benzoic acid (CID 155697042) is 2-[4-[[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]carbamoyl]phenoxy]benzoic acid.
What is the SMILES notation for 2-[4-[[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]carbamoyl]phenoxy]benzoic acid?
The canonical SMILES for 2-[4-[[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]carbamoyl]phenoxy]benzoic acid is CC1CC2CC(C1)CC(C)(c1ccc(NC(=O)c3ccc(Oc4ccccc4C(=O)O)cc3)cc1)C2.
What is the InChIKey of 2-[4-[[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]carbamoyl]phenoxy]benzoic acid?
The InChIKey is ZOUCBDJRENUFIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H33NO4/c1-20-15-21-17-22(16-20)19-31(2,18-21)24-9-11-25(12-10-24)32-29(33)23-7-13-26(14-8-23)36-28-6-4-3-5-27(28)30(34)35/h3-14,20-22H,15-19H2,1-2H3,(H,32,33)(H,34,35).
What are the key properties of 2-[4-[[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]carbamoyl]phenoxy]benzoic acid?
2-[4-[[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]carbamoyl]phenoxy]benzoic acid has a molecular weight of 483.61 g/mol, XLogP of 7.53, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[[4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)phenyl]carbamoyl]phenoxy]benzoic acid is sourced from PubChem (CID 155697042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).