C30H31NO4 — CID 155134364
2-[4-[[4-(1-adamantyl)anilino]-hydroxymethyl]phenoxy]benzoic acid (PubChem CID 155134364) has the molecular formula C30H31NO4 and a molecular weight of 469.58 g/mol. Its IUPAC name is 2-[4-[[4-(1-adamantyl)anilino]-hydroxymethyl]phenoxy]benzoic acid.
| Compound Name | 2-[4-[[4-(1-adamantyl)anilino]-hydroxymethyl]phenoxy]benzoic acid |
|---|---|
| PubChem CID | 155134364 |
| Molecular Formula | C30H31NO4 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 2-[4-[[4-(1-adamantyl)anilino]-hydroxymethyl]phenoxy]benzoic acid |
| SMILES | O=C(O)c1ccccc1Oc1ccc(C(O)Nc2ccc(C34CC5CC(CC(C5)C3)C4)cc2)cc1 |
| InChI | InChI=1S/C30H31NO4/c32-28(22-5-11-25(12-6-22)35-27-4-2-1-3-26(27)29(33)34)31-24-9-7-23(8-10-24)30-16-19-13-20(17-30)15-21(14-19)18-30/h1-12,19-21,28,31-32H,13-18H2,(H,33,34) |
| InChIKey | TZAJRJSFJCOTKZ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|