C26H31N3O2 — CID 7928876
(2R)-2-[4-(1-adamantyl)anilino]-N-(methylcarbamoyl)-2-phenylacetamide (PubChem CID 7928876) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is (2R)-2-[4-(1-adamantyl)anilino]-N-(methylcarbamoyl)-2-phenylacetamide.
| Compound Name | (2R)-2-[4-(1-adamantyl)anilino]-N-(methylcarbamoyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 7928876 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | (2R)-2-[4-(1-adamantyl)anilino]-N-(methylcarbamoyl)-2-phenylacetamide |
| SMILES | CNC(=O)NC(=O)[C@H](Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H31N3O2/c1-27-25(31)29-24(30)23(20-5-3-2-4-6-20)28-22-9-7-21(8-10-22)26-14-17-11-18(15-26)13-19(12-17)16-26/h2-10,17-19,23,28H,11-16H2,1H3,(H2,27,29,30,31)/t17?,18?,19?,23-,26?/m1/s1 |
| InChIKey | UKSAVAODFYMJNE-DHUDBDOYSA-N |
| XLogP | 4.76 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |