C22H28N2O4 — CID 7695835
[(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(1-adamantyl)acetate (PubChem CID 7695835) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is [(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(1-adamantyl)acetate.
| Compound Name | [(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(1-adamantyl)acetate |
|---|---|
| PubChem CID | 7695835 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | [(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(1-adamantyl)acetate |
| SMILES | CNC(=O)NC(=O)[C@@H](OC(=O)CC12CC3CC(CC(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C22H28N2O4/c1-23-21(27)24-20(26)19(17-5-3-2-4-6-17)28-18(25)13-22-10-14-7-15(11-22)9-16(8-14)12-22/h2-6,14-16,19H,7-13H2,1H3,(H2,23,24,26,27)/t14?,15?,16?,19-,22?/m0/s1 |
| InChIKey | ZKYKUWHMBSPAFQ-NAVXVDNBSA-N |
| XLogP | 3.33 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |