C21H26N2O4 — CID 46813921
[2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] adamantane-2-carboxylate (PubChem CID 46813921) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] adamantane-2-carboxylate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] adamantane-2-carboxylate |
|---|---|
| PubChem CID | 46813921 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] adamantane-2-carboxylate |
| SMILES | CNC(=O)NC(=O)C(OC(=O)C1C2CC3CC(C2)CC1C3)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O4/c1-22-21(26)23-19(24)18(14-5-3-2-4-6-14)27-20(25)17-15-8-12-7-13(10-15)11-16(17)9-12/h2-6,12-13,15-18H,7-11H2,1H3,(H2,22,23,24,26) |
| InChIKey | PQCHKKPTNCKTDN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |