C24H24N4O4 — CID 17495973
N-(4-methoxyphenyl)-4-[[2-(methylcarbamoylamino)-2-oxo-1-phenylethyl]amino]benzamide (PubChem CID 17495973) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-4-[[2-(methylcarbamoylamino)-2-oxo-1-phenylethyl]amino]benzamide.
| Compound Name | N-(4-methoxyphenyl)-4-[[2-(methylcarbamoylamino)-2-oxo-1-phenylethyl]amino]benzamide |
|---|---|
| PubChem CID | 17495973 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | N-(4-methoxyphenyl)-4-[[2-(methylcarbamoylamino)-2-oxo-1-phenylethyl]amino]benzamide |
| SMILES | CNC(=O)NC(=O)C(Nc1ccc(C(=O)Nc2ccc(OC)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H24N4O4/c1-25-24(31)28-23(30)21(16-6-4-3-5-7-16)26-18-10-8-17(9-11-18)22(29)27-19-12-14-20(32-2)15-13-19/h3-15,21,26H,1-2H3,(H,27,29)(H2,25,28,30,31) |
| InChIKey | CLGMNXSSZOIVAG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |