About benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate
benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate (PubChem CID 126182220) has the molecular formula C28H23NO4
and a molecular weight of 437.50 g/mol. Its IUPAC name is benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate.
Molecular Properties
| Compound Name | benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate |
| PubChem CID | 126182220 |
| Molecular Formula | C28H23NO4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate |
| SMILES | COc1ccc(C(=O)Nc2ccc(C(=O)OC(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H23NO4/c1-32-25-18-14-22(15-19-25)27(30)29-24-16-12-23(13-17-24)28(31)33-26(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-19,26H,1H3,(H,29,30) |
| InChIKey | FINPSUJVVKTGGD-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate?
The IUPAC name of benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate (CID 126182220) is benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate.
What is the SMILES notation for benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate?
The canonical SMILES for benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate is COc1ccc(C(=O)Nc2ccc(C(=O)OC(c3ccccc3)c3ccccc3)cc2)cc1.
What is the InChIKey of benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate?
The InChIKey is FINPSUJVVKTGGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H23NO4/c1-32-25-18-14-22(15-19-25)27(30)29-24-16-12-23(13-17-24)28(31)33-26(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-19,26H,1H3,(H,29,30).
What are the key properties of benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate?
benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate has a molecular weight of 437.50 g/mol, XLogP of 5.89, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate is sourced from PubChem (CID 126182220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).