benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate

C28H23NO4 — CID 126182220

IUPACbenzhydryl 4-[(4-methoxybenzoyl)amino]benzoate
SMILESCOc1ccc(C(=O)Nc2ccc(C(=O)OC(c3ccccc3)c3ccccc3)cc2)cc1
InChIInChI=1S/C28H23NO4/c1-32-25-18-14-22(15-19-25)27(30)29-24-16-12-23(13-17-24)28(31)33-26(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-19,26H,1H3,(H,29,30)
InChIKeyFINPSUJVVKTGGD-UHFFFAOYSA-N
MW437.50 g/mol
LogP5.89
Rot. Bonds7

About benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate

benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate (PubChem CID 126182220) has the molecular formula C28H23NO4 and a molecular weight of 437.50 g/mol. Its IUPAC name is benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate.

Molecular Properties

Compound Namebenzhydryl 4-[(4-methoxybenzoyl)amino]benzoate
PubChem CID126182220
Molecular FormulaC28H23NO4
Molecular Weight437.50 g/mol
Exact Mass437.16
IUPAC Namebenzhydryl 4-[(4-methoxybenzoyl)amino]benzoate
SMILESCOc1ccc(C(=O)Nc2ccc(C(=O)OC(c3ccccc3)c3ccccc3)cc2)cc1
InChIInChI=1S/C28H23NO4/c1-32-25-18-14-22(15-19-25)27(30)29-24-16-12-23(13-17-24)28(31)33-26(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-19,26H,1H3,(H,29,30)
InChIKeyFINPSUJVVKTGGD-UHFFFAOYSA-N
XLogP5.89
TPSA64.63 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms33
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500437.50
LogP ≤ 55.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate?
The IUPAC name of benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate (CID 126182220) is benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate.
What is the SMILES notation for benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate?
The canonical SMILES for benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate is COc1ccc(C(=O)Nc2ccc(C(=O)OC(c3ccccc3)c3ccccc3)cc2)cc1.
What is the InChIKey of benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate?
The InChIKey is FINPSUJVVKTGGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H23NO4/c1-32-25-18-14-22(15-19-25)27(30)29-24-16-12-23(13-17-24)28(31)33-26(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-19,26H,1H3,(H,29,30).
What are the key properties of benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate?
benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate has a molecular weight of 437.50 g/mol, XLogP of 5.89, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydryl 4-[(4-methoxybenzoyl)amino]benzoate is sourced from PubChem (CID 126182220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).