C36H32O6 — CID 67520176
2-[2-[3-[2-(2-carboxyphenoxy)phenyl]-1-adamantyl]phenoxy]benzoic acid (PubChem CID 67520176) has the molecular formula C36H32O6 and a molecular weight of 560.65 g/mol. Its IUPAC name is 2-[2-[3-[2-(2-carboxyphenoxy)phenyl]-1-adamantyl]phenoxy]benzoic acid.
| Compound Name | 2-[2-[3-[2-(2-carboxyphenoxy)phenyl]-1-adamantyl]phenoxy]benzoic acid |
|---|---|
| PubChem CID | 67520176 |
| Molecular Formula | C36H32O6 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | 2-[2-[3-[2-(2-carboxyphenoxy)phenyl]-1-adamantyl]phenoxy]benzoic acid |
| SMILES | O=C(O)c1ccccc1Oc1ccccc1C12CC3CC(C1)CC(c1ccccc1Oc1ccccc1C(=O)O)(C3)C2 |
| InChI | InChI=1S/C36H32O6/c37-33(38)25-9-1-5-13-29(25)41-31-15-7-3-11-27(31)35-18-23-17-24(19-35)21-36(20-23,22-35)28-12-4-8-16-32(28)42-30-14-6-2-10-26(30)34(39)40/h1-16,23-24H,17-22H2,(H,37,38)(H,39,40) |
| InChIKey | KYOCTCPYKRXGLZ-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |