C66H74O6 — CID 87430895
2-(2-adamantyl)-3-[4-[3-[3-[4-[2-(2-adamantyl)-3-carboxyphenoxy]phenyl]-1-adamantyl]-1-adamantyl]phenoxy]benzoic acid (PubChem CID 87430895) has the molecular formula C66H74O6 and a molecular weight of 963.31 g/mol. Its IUPAC name is 2-(2-adamantyl)-3-[4-[3-[3-[4-[2-(2-adamantyl)-3-carboxyphenoxy]phenyl]-1-adamantyl]-1-adamantyl]phenoxy]benzoic acid.
| Compound Name | 2-(2-adamantyl)-3-[4-[3-[3-[4-[2-(2-adamantyl)-3-carboxyphenoxy]phenyl]-1-adamantyl]-1-adamantyl]phenoxy]benzoic acid |
|---|---|
| PubChem CID | 87430895 |
| Molecular Formula | C66H74O6 |
| Molecular Weight | 963.31 g/mol |
| Exact Mass | 962.55 |
| IUPAC Name | 2-(2-adamantyl)-3-[4-[3-[3-[4-[2-(2-adamantyl)-3-carboxyphenoxy]phenyl]-1-adamantyl]-1-adamantyl]phenoxy]benzoic acid |
| SMILES | O=C(O)c1cccc(Oc2ccc(C34CC5CC(C3)CC(C36CC7CC(CC(c8ccc(Oc9cccc(C(=O)O)c9C9C%10CC%11CC(C%10)CC9C%11)cc8)(C7)C3)C6)(C5)C4)cc2)c1C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C66H74O6/c67-61(68)53-3-1-5-55(59(53)57-45-19-37-15-38(21-45)22-46(57)20-37)71-51-11-7-49(8-12-51)63-27-41-17-42(28-63)32-65(31-41,35-63)66-33-43-18-44(34-66)30-64(29-43,36-66)50-9-13-52(14-10-50)72-56-6-2-4-54(62(69)70)60(56)58-47-23-39-16-40(25-47)26-48(58)24-39/h1-14,37-48,57-58H,15-36H2,(H,67,68)(H,69,70) |
| InChIKey | UXUYAMHVYILACL-UHFFFAOYSA-N |
| XLogP | 16.12 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.31 |
| LogP ≤ 5 | 16.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |