C42H42O10 — CID 67506832
4-[2,4-bis(1-adamantyl)-5-(3,4-dicarboxyphenoxy)phenoxy]phthalic acid (PubChem CID 67506832) has the molecular formula C42H42O10 and a molecular weight of 706.79 g/mol. Its IUPAC name is 4-[2,4-bis(1-adamantyl)-5-(3,4-dicarboxyphenoxy)phenoxy]phthalic acid.
| Compound Name | 4-[2,4-bis(1-adamantyl)-5-(3,4-dicarboxyphenoxy)phenoxy]phthalic acid |
|---|---|
| PubChem CID | 67506832 |
| Molecular Formula | C42H42O10 |
| Molecular Weight | 706.79 g/mol |
| Exact Mass | 706.28 |
| IUPAC Name | 4-[2,4-bis(1-adamantyl)-5-(3,4-dicarboxyphenoxy)phenoxy]phthalic acid |
| SMILES | O=C(O)c1ccc(Oc2cc(Oc3ccc(C(=O)O)c(C(=O)O)c3)c(C34CC5CC(CC(C5)C3)C4)cc2C23CC4CC(CC(C4)C2)C3)cc1C(=O)O |
| InChI | InChI=1S/C42H42O10/c43-37(44)29-3-1-27(11-31(29)39(47)48)51-35-14-36(52-28-2-4-30(38(45)46)32(12-28)40(49)50)34(42-18-24-8-25(19-42)10-26(9-24)20-42)13-33(35)41-15-21-5-22(16-41)7-23(6-21)17-41/h1-4,11-14,21-26H,5-10,15-20H2,(H,43,44)(H,45,46)(H,47,48)(H,49,50) |
| InChIKey | PFZPMZCOQOOMKA-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.79 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |