C26H30O6 — CID 10225137
4-[2-[3-(1-adamantyl)-4-methoxyphenyl]-2-hydroxyethoxy]-2-hydroxybenzoic acid (PubChem CID 10225137) has the molecular formula C26H30O6 and a molecular weight of 438.52 g/mol. Its IUPAC name is 4-[2-[3-(1-adamantyl)-4-methoxyphenyl]-2-hydroxyethoxy]-2-hydroxybenzoic acid.
| Compound Name | 4-[2-[3-(1-adamantyl)-4-methoxyphenyl]-2-hydroxyethoxy]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 10225137 |
| Molecular Formula | C26H30O6 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 4-[2-[3-(1-adamantyl)-4-methoxyphenyl]-2-hydroxyethoxy]-2-hydroxybenzoic acid |
| SMILES | COc1ccc(C(O)COc2ccc(C(=O)O)c(O)c2)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H30O6/c1-31-24-5-2-18(23(28)14-32-19-3-4-20(25(29)30)22(27)10-19)9-21(24)26-11-15-6-16(12-26)8-17(7-15)13-26/h2-5,9-10,15-17,23,27-28H,6-8,11-14H2,1H3,(H,29,30) |
| InChIKey | NOZHYBIGTYJUEA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |