C29H32O3 — CID 167027695
[6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalen-2-yl]-methoxymethanol (PubChem CID 167027695) has the molecular formula C29H32O3 and a molecular weight of 428.57 g/mol. Its IUPAC name is [6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalen-2-yl]-methoxymethanol.
| Compound Name | [6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalen-2-yl]-methoxymethanol |
|---|---|
| PubChem CID | 167027695 |
| Molecular Formula | C29H32O3 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | [6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalen-2-yl]-methoxymethanol |
| SMILES | COc1ccc(-c2ccc3cc(C(O)OC)ccc3c2)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C29H32O3/c1-31-27-8-7-24(14-26(27)29-15-18-9-19(16-29)11-20(10-18)17-29)22-3-4-23-13-25(28(30)32-2)6-5-21(23)12-22/h3-8,12-14,18-20,28,30H,9-11,15-17H2,1-2H3 |
| InChIKey | NWZRVUYMQLTGEG-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|