C28H28O2S — CID 177352938
S-methyl 6-[4-methoxy-3-(1-tricyclo[3.3.1.03,7]nonanyl)phenyl]naphthalene-2-carbothioate (PubChem CID 177352938) has the molecular formula C28H28O2S and a molecular weight of 428.60 g/mol. Its IUPAC name is S-methyl 6-[4-methoxy-3-(1-tricyclo[3.3.1.03,7]nonanyl)phenyl]naphthalene-2-carbothioate.
| Compound Name | S-methyl 6-[4-methoxy-3-(1-tricyclo[3.3.1.03,7]nonanyl)phenyl]naphthalene-2-carbothioate |
|---|---|
| PubChem CID | 177352938 |
| Molecular Formula | C28H28O2S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | S-methyl 6-[4-methoxy-3-(1-tricyclo[3.3.1.03,7]nonanyl)phenyl]naphthalene-2-carbothioate |
| SMILES | COc1ccc(-c2ccc3cc(C(=O)SC)ccc3c2)cc1C12CC3CC(C1)C(C3)C2 |
| InChI | InChI=1S/C28H28O2S/c1-30-26-8-7-21(13-25(26)28-14-17-9-23(15-28)24(10-17)16-28)19-3-4-20-12-22(27(29)31-2)6-5-18(20)11-19/h3-8,11-13,17,23-24H,9-10,14-16H2,1-2H3 |
| InChIKey | BBUKLDKYMBMKIY-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|