C30H31O3- — CID 22560601
6-[3-(3,5-dimethyl-1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylate (PubChem CID 22560601) has the molecular formula C30H31O3- and a molecular weight of 439.58 g/mol. Its IUPAC name is 6-[3-(3,5-dimethyl-1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylate.
| Compound Name | 6-[3-(3,5-dimethyl-1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 22560601 |
| Molecular Formula | C30H31O3- |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 6-[3-(3,5-dimethyl-1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylate |
| SMILES | COc1ccc(-c2ccc3cc(C(=O)[O-])ccc3c2)cc1C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C30H32O3/c1-28-13-19-14-29(2,16-28)18-30(15-19,17-28)25-12-23(8-9-26(25)33-3)21-4-5-22-11-24(27(31)32)7-6-20(22)10-21/h4-12,19H,13-18H2,1-3H3,(H,31,32)/p-1 |
| InChIKey | JDRBYJFGJWESHM-UHFFFAOYSA-M |
| XLogP | 6.13 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |