C28H27LiO3 — CID 23672375
lithium 6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylate (PubChem CID 23672375) has the molecular formula C28H27LiO3 and a molecular weight of 418.46 g/mol. Its IUPAC name is lithium 6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylate.
| Compound Name | lithium 6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 23672375 |
| Molecular Formula | C28H27LiO3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | lithium 6-[3-(1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylate |
| SMILES | COc1ccc(-c2ccc3cc(C(=O)[O-])ccc3c2)cc1C12CC3CC(CC(C3)C1)C2.[Li+] |
| InChI | InChI=1S/C28H28O3.Li/c1-31-26-7-6-23(21-2-3-22-12-24(27(29)30)5-4-20(22)11-21)13-25(26)28-14-17-8-18(15-28)10-19(9-17)16-28;/h2-7,11-13,17-19H,8-10,14-16H2,1H3,(H,29,30);/q;+1/p-1 |
| InChIKey | JTVYYOVRJXDZDE-UHFFFAOYSA-M |
| XLogP | 2.35 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |