C30H32O3 — CID 143380631
ethene;methyl 6-[3-(1-adamantyl)-4-hydroxyphenyl]naphthalene-2-carboxylate (PubChem CID 143380631) has the molecular formula C30H32O3 and a molecular weight of 440.58 g/mol. Its IUPAC name is ethene;methyl 6-[3-(1-adamantyl)-4-hydroxyphenyl]naphthalene-2-carboxylate.
| Compound Name | ethene;methyl 6-[3-(1-adamantyl)-4-hydroxyphenyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 143380631 |
| Molecular Formula | C30H32O3 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | ethene;methyl 6-[3-(1-adamantyl)-4-hydroxyphenyl]naphthalene-2-carboxylate |
| SMILES | C=C.COC(=O)c1ccc2cc(-c3ccc(O)c(C45CC6CC(CC(C6)C4)C5)c3)ccc2c1 |
| InChI | InChI=1S/C28H28O3.C2H4/c1-31-27(30)24-5-4-20-11-21(2-3-22(20)12-24)23-6-7-26(29)25(13-23)28-14-17-8-18(15-28)10-19(9-17)16-28;1-2/h2-7,11-13,17-19,29H,8-10,14-16H2,1H3;1-2H2 |
| InChIKey | JLXJUDDTAKIPPV-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|