C26H27FO3 — CID 11463895
methyl (E)-3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]-2-fluorophenyl]prop-2-enoate (PubChem CID 11463895) has the molecular formula C26H27FO3 and a molecular weight of 406.50 g/mol. Its IUPAC name is methyl (E)-3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]-2-fluorophenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]-2-fluorophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 11463895 |
| Molecular Formula | C26H27FO3 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | methyl (E)-3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]-2-fluorophenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(-c2ccc(O)c(C34CC5CC(CC(C5)C3)C4)c2)cc1F |
| InChI | InChI=1S/C26H27FO3/c1-30-25(29)7-5-19-2-3-21(12-23(19)27)20-4-6-24(28)22(11-20)26-13-16-8-17(14-26)10-18(9-16)15-26/h2-7,11-12,16-18,28H,8-10,13-15H2,1H3/b7-5+ |
| InChIKey | WNVWPNFXBUMJES-FNORWQNLSA-N |
| XLogP | 5.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|