C26H27O4- — CID 54719344
2-(1-adamantyl)-4-[3-[(E)-2-carboxyethenyl]-4-methoxyphenyl]phenolate (PubChem CID 54719344) has the molecular formula C26H27O4- and a molecular weight of 403.50 g/mol. Its IUPAC name is 2-(1-adamantyl)-4-[3-[(E)-2-carboxyethenyl]-4-methoxyphenyl]phenolate.
| Compound Name | 2-(1-adamantyl)-4-[3-[(E)-2-carboxyethenyl]-4-methoxyphenyl]phenolate |
|---|---|
| PubChem CID | 54719344 |
| Molecular Formula | C26H27O4- |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 2-(1-adamantyl)-4-[3-[(E)-2-carboxyethenyl]-4-methoxyphenyl]phenolate |
| SMILES | COc1ccc(-c2ccc([O-])c(C34CC5CC(CC(C5)C3)C4)c2)cc1/C=C/C(=O)O |
| InChI | InChI=1S/C26H28O4/c1-30-24-6-3-19(11-21(24)4-7-25(28)29)20-2-5-23(27)22(12-20)26-13-16-8-17(14-26)10-18(9-16)15-26/h2-7,11-12,16-18,27H,8-10,13-15H2,1H3,(H,28,29)/p-1/b7-4+ |
| InChIKey | PEVOZBXLKNXPEO-QPJJXVBHSA-M |
| XLogP | 5.00 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|