C29H34O4 — CID 155758933
3-[4-[3-(1-adamantyl)-4-(4-hydroxybutoxy)phenyl]phenyl]prop-2-enoic acid (PubChem CID 155758933) has the molecular formula C29H34O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is 3-[4-[3-(1-adamantyl)-4-(4-hydroxybutoxy)phenyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[3-(1-adamantyl)-4-(4-hydroxybutoxy)phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 155758933 |
| Molecular Formula | C29H34O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 3-[4-[3-(1-adamantyl)-4-(4-hydroxybutoxy)phenyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(-c2ccc(OCCCCO)c(C34CC5CC(CC(C5)C3)C4)c2)cc1 |
| InChI | InChI=1S/C29H34O4/c30-11-1-2-12-33-27-9-8-25(24-6-3-20(4-7-24)5-10-28(31)32)16-26(27)29-17-21-13-22(18-29)15-23(14-21)19-29/h3-10,16,21-23,30H,1-2,11-15,17-19H2,(H,31,32) |
| InChIKey | WYYGFZDBQCLUBV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|