C27H33NO5 — CID 134388688
(E)-3-[4-[4-[5-(hydroxyamino)-5-oxopentoxy]-3-(1-methylcyclohexyl)phenyl]phenyl]prop-2-enoic acid (PubChem CID 134388688) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is (E)-3-[4-[4-[5-(hydroxyamino)-5-oxopentoxy]-3-(1-methylcyclohexyl)phenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[4-[5-(hydroxyamino)-5-oxopentoxy]-3-(1-methylcyclohexyl)phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 134388688 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | (E)-3-[4-[4-[5-(hydroxyamino)-5-oxopentoxy]-3-(1-methylcyclohexyl)phenyl]phenyl]prop-2-enoic acid |
| SMILES | CC1(c2cc(-c3ccc(/C=C/C(=O)O)cc3)ccc2OCCCCC(=O)NO)CCCCC1 |
| InChI | InChI=1S/C27H33NO5/c1-27(16-4-2-5-17-27)23-19-22(21-11-8-20(9-12-21)10-15-26(30)31)13-14-24(23)33-18-6-3-7-25(29)28-32/h8-15,19,32H,2-7,16-18H2,1H3,(H,28,29)(H,30,31)/b15-10+ |
| InChIKey | CYJWQHMDZZEOQP-XNTDXEJSSA-N |
| XLogP | 5.73 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|