C28H38O3Si — CID 67685732
4-[(E)-2-[4-[tert-butyl(dimethyl)silyl]oxy-3-(1-methylcyclohexyl)phenyl]ethenyl]benzoic acid (PubChem CID 67685732) has the molecular formula C28H38O3Si and a molecular weight of 450.70 g/mol. Its IUPAC name is 4-[(E)-2-[4-[tert-butyl(dimethyl)silyl]oxy-3-(1-methylcyclohexyl)phenyl]ethenyl]benzoic acid.
| Compound Name | 4-[(E)-2-[4-[tert-butyl(dimethyl)silyl]oxy-3-(1-methylcyclohexyl)phenyl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 67685732 |
| Molecular Formula | C28H38O3Si |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 4-[(E)-2-[4-[tert-butyl(dimethyl)silyl]oxy-3-(1-methylcyclohexyl)phenyl]ethenyl]benzoic acid |
| SMILES | CC1(c2cc(/C=C/c3ccc(C(=O)O)cc3)ccc2O[Si](C)(C)C(C)(C)C)CCCCC1 |
| InChI | InChI=1S/C28H38O3Si/c1-27(2,3)32(5,6)31-25-17-14-22(20-24(25)28(4)18-8-7-9-19-28)11-10-21-12-15-23(16-13-21)26(29)30/h10-17,20H,7-9,18-19H2,1-6H3,(H,29,30)/b11-10+ |
| InChIKey | HKKHULLNUBVOIF-ZHACJKMWSA-N |
| XLogP | 8.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|