C20H30O3Si — CID 21107237
6-[tert-butyl(dimethyl)silyl]oxy-4,4,7-trimethyl-3H-naphthalene-1-carboxylic acid (PubChem CID 21107237) has the molecular formula C20H30O3Si and a molecular weight of 346.54 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-4,4,7-trimethyl-3H-naphthalene-1-carboxylic acid.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-4,4,7-trimethyl-3H-naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 21107237 |
| Molecular Formula | C20H30O3Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-4,4,7-trimethyl-3H-naphthalene-1-carboxylic acid |
| SMILES | Cc1cc2c(cc1O[Si](C)(C)C(C)(C)C)C(C)(C)CC=C2C(=O)O |
| InChI | InChI=1S/C20H30O3Si/c1-13-11-15-14(18(21)22)9-10-20(5,6)16(15)12-17(13)23-24(7,8)19(2,3)4/h9,11-12H,10H2,1-8H3,(H,21,22) |
| InChIKey | LGHLRNFFNDFEDK-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|