C18H26O — CID 22218198
4-tert-butyl-6-methoxy-1,1,7-trimethyl-2H-naphthalene (PubChem CID 22218198) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is 4-tert-butyl-6-methoxy-1,1,7-trimethyl-2H-naphthalene.
| Compound Name | 4-tert-butyl-6-methoxy-1,1,7-trimethyl-2H-naphthalene |
|---|---|
| PubChem CID | 22218198 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 4-tert-butyl-6-methoxy-1,1,7-trimethyl-2H-naphthalene |
| SMILES | COc1cc2c(cc1C)C(C)(C)CC=C2C(C)(C)C |
| InChI | InChI=1S/C18H26O/c1-12-10-15-13(11-16(12)19-7)14(17(2,3)4)8-9-18(15,5)6/h8,10-11H,9H2,1-7H3 |
| InChIKey | FNSMYEVBZZYSGX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |