C24H33NO4Si — CID 174190151
[3-[tert-butyl(dimethyl)silyl]oxy-2,6,6,9-tetramethylbenzo[c]chromen-8-yl] carbamate (PubChem CID 174190151) has the molecular formula C24H33NO4Si and a molecular weight of 427.62 g/mol. Its IUPAC name is [3-[tert-butyl(dimethyl)silyl]oxy-2,6,6,9-tetramethylbenzo[c]chromen-8-yl] carbamate.
| Compound Name | [3-[tert-butyl(dimethyl)silyl]oxy-2,6,6,9-tetramethylbenzo[c]chromen-8-yl] carbamate |
|---|---|
| PubChem CID | 174190151 |
| Molecular Formula | C24H33NO4Si |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | [3-[tert-butyl(dimethyl)silyl]oxy-2,6,6,9-tetramethylbenzo[c]chromen-8-yl] carbamate |
| SMILES | Cc1cc2c(cc1OC(N)=O)C(C)(C)Oc1cc(O[Si](C)(C)C(C)(C)C)c(C)cc1-2 |
| InChI | InChI=1S/C24H33NO4Si/c1-14-10-16-17-11-15(2)20(29-30(8,9)23(3,4)5)13-21(17)28-24(6,7)18(16)12-19(14)27-22(25)26/h10-13H,1-9H3,(H2,25,26) |
| InChIKey | FWOYPMSVKYRQNJ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|