C19H21NO4 — CID 174190161
(8-methoxy-2,6,6,9-tetramethylbenzo[c]chromen-3-yl)carbamic acid (PubChem CID 174190161) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is (8-methoxy-2,6,6,9-tetramethylbenzo[c]chromen-3-yl)carbamic acid.
| Compound Name | (8-methoxy-2,6,6,9-tetramethylbenzo[c]chromen-3-yl)carbamic acid |
|---|---|
| PubChem CID | 174190161 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (8-methoxy-2,6,6,9-tetramethylbenzo[c]chromen-3-yl)carbamic acid |
| SMILES | COc1cc2c(cc1C)-c1cc(C)c(NC(=O)O)cc1OC2(C)C |
| InChI | InChI=1S/C19H21NO4/c1-10-6-13-12-7-11(2)16(23-5)8-14(12)19(3,4)24-17(13)9-15(10)20-18(21)22/h6-9,20H,1-5H3,(H,21,22) |
| InChIKey | FRKXENUBJZKXKI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |