C16H22O3 — CID 164671819
(1S)-4-methoxy-1,5,11,11-tetramethyl-8-oxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-9-ol (PubChem CID 164671819) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (1S)-4-methoxy-1,5,11,11-tetramethyl-8-oxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-9-ol.
| Compound Name | (1S)-4-methoxy-1,5,11,11-tetramethyl-8-oxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-9-ol |
|---|---|
| PubChem CID | 164671819 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (1S)-4-methoxy-1,5,11,11-tetramethyl-8-oxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-9-ol |
| SMILES | COc1cc2c(cc1C)OC1(O)CC(C)(C)[C@]2(C)C1 |
| InChI | InChI=1S/C16H22O3/c1-10-6-13-11(7-12(10)18-5)15(4)9-16(17,19-13)8-14(15,2)3/h6-7,17H,8-9H2,1-5H3/t15-,16?/m1/s1 |
| InChIKey | MRCWGBRALUGHHZ-AAFJCEBUSA-N |
| XLogP | 3.16 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |