C16H20O3 — CID 56957842
(1S,9R)-1-ethenyl-4-methoxy-5,10,10-trimethyl-8,11-dioxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene (PubChem CID 56957842) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is (1S,9R)-1-ethenyl-4-methoxy-5,10,10-trimethyl-8,11-dioxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene.
| Compound Name | (1S,9R)-1-ethenyl-4-methoxy-5,10,10-trimethyl-8,11-dioxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 56957842 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (1S,9R)-1-ethenyl-4-methoxy-5,10,10-trimethyl-8,11-dioxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
| SMILES | C=C[C@@]12C[C@@H](Oc3cc(C)c(OC)cc31)C(C)(C)O2 |
| InChI | InChI=1S/C16H20O3/c1-6-16-9-14(15(3,4)19-16)18-13-7-10(2)12(17-5)8-11(13)16/h6-8,14H,1,9H2,2-5H3/t14-,16-/m1/s1 |
| InChIKey | HKIHNZSWZKDOJJ-GDBMZVCRSA-N |
| XLogP | 3.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|