C17H24O3 — CID 164671207
(3S)-3-[(2R)-2-(2,5-dimethoxy-4-methylphenyl)but-3-enyl]-2,2-dimethyloxirane (PubChem CID 164671207) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (3S)-3-[(2R)-2-(2,5-dimethoxy-4-methylphenyl)but-3-enyl]-2,2-dimethyloxirane.
| Compound Name | (3S)-3-[(2R)-2-(2,5-dimethoxy-4-methylphenyl)but-3-enyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 164671207 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (3S)-3-[(2R)-2-(2,5-dimethoxy-4-methylphenyl)but-3-enyl]-2,2-dimethyloxirane |
| SMILES | C=C[C@@H](C[C@@H]1OC1(C)C)c1cc(OC)c(C)cc1OC |
| InChI | InChI=1S/C17H24O3/c1-7-12(9-16-17(3,4)20-16)13-10-14(18-5)11(2)8-15(13)19-6/h7-8,10,12,16H,1,9H2,2-6H3/t12-,16-/m0/s1 |
| InChIKey | GSTGFTZSEOUGOI-LRDDRELGSA-N |
| XLogP | 3.85 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|