C19H28O5 — CID 11660065
ethyl 3-[2-(1-hydroxy-2-methylpropan-2-yl)oxy-5-methoxy-4-methylphenyl]pent-4-enoate (PubChem CID 11660065) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is ethyl 3-[2-(1-hydroxy-2-methylpropan-2-yl)oxy-5-methoxy-4-methylphenyl]pent-4-enoate.
| Compound Name | ethyl 3-[2-(1-hydroxy-2-methylpropan-2-yl)oxy-5-methoxy-4-methylphenyl]pent-4-enoate |
|---|---|
| PubChem CID | 11660065 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | ethyl 3-[2-(1-hydroxy-2-methylpropan-2-yl)oxy-5-methoxy-4-methylphenyl]pent-4-enoate |
| SMILES | C=CC(CC(=O)OCC)c1cc(OC)c(C)cc1OC(C)(C)CO |
| InChI | InChI=1S/C19H28O5/c1-7-14(10-18(21)23-8-2)15-11-16(22-6)13(3)9-17(15)24-19(4,5)12-20/h7,9,11,14,20H,1,8,10,12H2,2-6H3 |
| InChIKey | GDFKNDZECMWFNL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|