C15H23NO2 — CID 123959418
2-(4,5-dimethoxy-2-methylphenyl)-1,2,4-trimethylazetidine (PubChem CID 123959418) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-methylphenyl)-1,2,4-trimethylazetidine.
| Compound Name | 2-(4,5-dimethoxy-2-methylphenyl)-1,2,4-trimethylazetidine |
|---|---|
| PubChem CID | 123959418 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-(4,5-dimethoxy-2-methylphenyl)-1,2,4-trimethylazetidine |
| SMILES | COc1cc(C)c(C2(C)CC(C)N2C)cc1OC |
| InChI | InChI=1S/C15H23NO2/c1-10-7-13(17-5)14(18-6)8-12(10)15(3)9-11(2)16(15)4/h7-8,11H,9H2,1-6H3 |
| InChIKey | WDOXZVNQFCAVGC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |