C19H26O5 — CID 71601416
8-(2,5-dimethoxy-4-methylphenyl)-7,7-dimethyl-1,4-dioxaspiro[4.4]nonane-8-carbaldehyde (PubChem CID 71601416) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is 8-(2,5-dimethoxy-4-methylphenyl)-7,7-dimethyl-1,4-dioxaspiro[4.4]nonane-8-carbaldehyde.
| Compound Name | 8-(2,5-dimethoxy-4-methylphenyl)-7,7-dimethyl-1,4-dioxaspiro[4.4]nonane-8-carbaldehyde |
|---|---|
| PubChem CID | 71601416 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 8-(2,5-dimethoxy-4-methylphenyl)-7,7-dimethyl-1,4-dioxaspiro[4.4]nonane-8-carbaldehyde |
| SMILES | COc1cc(C2(C=O)CC3(CC2(C)C)OCCO3)c(OC)cc1C |
| InChI | InChI=1S/C19H26O5/c1-13-8-16(22-5)14(9-15(13)21-4)18(12-20)11-19(10-17(18,2)3)23-6-7-24-19/h8-9,12H,6-7,10-11H2,1-5H3 |
| InChIKey | WTWLAUDGWMYFAP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|