C26H36O4S — CID 143547675
ethane;6-methoxy-4,4,4',4',7,7'-hexamethyl-6'-sulfanyloxy-2,2'-spirobi[3H-chromene] (PubChem CID 143547675) has the molecular formula C26H36O4S and a molecular weight of 444.64 g/mol. Its IUPAC name is ethane;6-methoxy-4,4,4',4',7,7'-hexamethyl-6'-sulfanyloxy-2,2'-spirobi[3H-chromene].
| Compound Name | ethane;6-methoxy-4,4,4',4',7,7'-hexamethyl-6'-sulfanyloxy-2,2'-spirobi[3H-chromene] |
|---|---|
| PubChem CID | 143547675 |
| Molecular Formula | C26H36O4S |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | ethane;6-methoxy-4,4,4',4',7,7'-hexamethyl-6'-sulfanyloxy-2,2'-spirobi[3H-chromene] |
| SMILES | CC.COc1cc2c(cc1C)OC1(CC2(C)C)CC(C)(C)c2cc(OS)c(C)cc2O1 |
| InChI | InChI=1S/C24H30O4S.C2H6/c1-14-8-20-16(10-18(14)25-7)22(3,4)12-24(26-20)13-23(5,6)17-11-19(28-29)15(2)9-21(17)27-24;1-2/h8-11,29H,12-13H2,1-7H3;1-2H3 |
| InChIKey | XIYDKTSABREPEN-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|