C16H22O3 — CID 101446235
(3R,5S)-5-ethenyl-7-methoxy-2,2,8-trimethyl-4,5-dihydro-3H-1-benzoxepin-3-ol (PubChem CID 101446235) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (3R,5S)-5-ethenyl-7-methoxy-2,2,8-trimethyl-4,5-dihydro-3H-1-benzoxepin-3-ol.
| Compound Name | (3R,5S)-5-ethenyl-7-methoxy-2,2,8-trimethyl-4,5-dihydro-3H-1-benzoxepin-3-ol |
|---|---|
| PubChem CID | 101446235 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (3R,5S)-5-ethenyl-7-methoxy-2,2,8-trimethyl-4,5-dihydro-3H-1-benzoxepin-3-ol |
| SMILES | C=C[C@@H]1C[C@@H](O)C(C)(C)Oc2cc(C)c(OC)cc21 |
| InChI | InChI=1S/C16H22O3/c1-6-11-8-15(17)16(3,4)19-14-7-10(2)13(18-5)9-12(11)14/h6-7,9,11,15,17H,1,8H2,2-5H3/t11-,15-/m1/s1 |
| InChIKey | WFBBBIROCMNTSE-IAQYHMDHSA-N |
| XLogP | 3.20 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|