C16H22O — CID 25269693
(1R,3S)-6-methoxy-1,5-dimethyl-3-(2-methylprop-1-enyl)-2,3-dihydro-1H-indene (PubChem CID 25269693) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is (1R,3S)-6-methoxy-1,5-dimethyl-3-(2-methylprop-1-enyl)-2,3-dihydro-1H-indene.
| Compound Name | (1R,3S)-6-methoxy-1,5-dimethyl-3-(2-methylprop-1-enyl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 25269693 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (1R,3S)-6-methoxy-1,5-dimethyl-3-(2-methylprop-1-enyl)-2,3-dihydro-1H-indene |
| SMILES | COc1cc2c(cc1C)[C@H](C=C(C)C)C[C@H]2C |
| InChI | InChI=1S/C16H22O/c1-10(2)6-13-7-11(3)14-9-16(17-5)12(4)8-15(13)14/h6,8-9,11,13H,7H2,1-5H3/t11-,13-/m1/s1 |
| InChIKey | QORAPABCLIHCNY-DGCLKSJQSA-N |
| XLogP | 4.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|