About 1-bromo-5,6-dimethoxy-3-methyl-2,3-dihydro-1H-indene
1-bromo-5,6-dimethoxy-3-methyl-2,3-dihydro-1H-indene (PubChem CID 63821934) has the molecular formula C12H15BrO2
and a molecular weight of 271.15 g/mol. Its IUPAC name is 1-bromo-5,6-dimethoxy-3-methyl-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 1-bromo-5,6-dimethoxy-3-methyl-2,3-dihydro-1H-indene |
| PubChem CID | 63821934 |
| Molecular Formula | C12H15BrO2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 1-bromo-5,6-dimethoxy-3-methyl-2,3-dihydro-1H-indene |
| SMILES | COc1cc2c(cc1OC)C(Br)CC2C |
| InChI | InChI=1S/C12H15BrO2/c1-7-4-10(13)9-6-12(15-3)11(14-2)5-8(7)9/h5-7,10H,4H2,1-3H3 |
| InChIKey | IDWCAYIUWGUKGJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-5,6-dimethoxy-3-methyl-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-5,6-dimethoxy-3-methyl-2,3-dihydro-1H-indene?
The IUPAC name of 1-bromo-5,6-dimethoxy-3-methyl-2,3-dihydro-1H-indene (CID 63821934) is 1-bromo-5,6-dimethoxy-3-methyl-2,3-dihydro-1H-indene.
What is the SMILES notation for 1-bromo-5,6-dimethoxy-3-methyl-2,3-dihydro-1H-indene?
The canonical SMILES for 1-bromo-5,6-dimethoxy-3-methyl-2,3-dihydro-1H-indene is COc1cc2c(cc1OC)C(Br)CC2C.
What is the InChIKey of 1-bromo-5,6-dimethoxy-3-methyl-2,3-dihydro-1H-indene?
The InChIKey is IDWCAYIUWGUKGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrO2/c1-7-4-10(13)9-6-12(15-3)11(14-2)5-8(7)9/h5-7,10H,4H2,1-3H3.
What are the key properties of 1-bromo-5,6-dimethoxy-3-methyl-2,3-dihydro-1H-indene?
1-bromo-5,6-dimethoxy-3-methyl-2,3-dihydro-1H-indene has a molecular weight of 271.15 g/mol, XLogP of 3.65, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-5,6-dimethoxy-3-methyl-2,3-dihydro-1H-indene is sourced from PubChem (CID 63821934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).