C21H20O6 — CID 137412659
4,5,12,13-tetramethoxytetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene-8,16-dione (PubChem CID 137412659) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is 4,5,12,13-tetramethoxytetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene-8,16-dione.
| Compound Name | 4,5,12,13-tetramethoxytetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene-8,16-dione |
|---|---|
| PubChem CID | 137412659 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 4,5,12,13-tetramethoxytetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene-8,16-dione |
| SMILES | COc1cc2c(cc1OC)C1CC(C2=O)c2cc(OC)c(OC)cc2C1=O |
| InChI | InChI=1S/C21H20O6/c1-24-16-6-10-12-5-13(21(23)14(10)8-18(16)26-3)11-7-17(25-2)19(27-4)9-15(11)20(12)22/h6-9,12-13H,5H2,1-4H3 |
| InChIKey | WEUPSDJMEGJAAU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |