About 5,6-dimethoxy-3-methyl-2,3-dihydroinden-1-one
5,6-dimethoxy-3-methyl-2,3-dihydroinden-1-one (PubChem CID 605781) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is 5,6-dimethoxy-3-methyl-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 5,6-dimethoxy-3-methyl-2,3-dihydroinden-1-one |
| PubChem CID | 605781 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 5,6-dimethoxy-3-methyl-2,3-dihydroinden-1-one |
| SMILES | COc1cc2c(cc1OC)C(C)CC2=O |
| InChI | InChI=1S/C12H14O3/c1-7-4-10(13)9-6-12(15-3)11(14-2)5-8(7)9/h5-7H,4H2,1-3H3 |
| InChIKey | SOCFELMKQMPCFC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,6-dimethoxy-3-methyl-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethoxy-3-methyl-2,3-dihydroinden-1-one?
The IUPAC name of 5,6-dimethoxy-3-methyl-2,3-dihydroinden-1-one (CID 605781) is 5,6-dimethoxy-3-methyl-2,3-dihydroinden-1-one.
What is the SMILES notation for 5,6-dimethoxy-3-methyl-2,3-dihydroinden-1-one?
The canonical SMILES for 5,6-dimethoxy-3-methyl-2,3-dihydroinden-1-one is COc1cc2c(cc1OC)C(C)CC2=O.
What is the InChIKey of 5,6-dimethoxy-3-methyl-2,3-dihydroinden-1-one?
The InChIKey is SOCFELMKQMPCFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-7-4-10(13)9-6-12(15-3)11(14-2)5-8(7)9/h5-7H,4H2,1-3H3.
What are the key properties of 5,6-dimethoxy-3-methyl-2,3-dihydroinden-1-one?
5,6-dimethoxy-3-methyl-2,3-dihydroinden-1-one has a molecular weight of 206.24 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethoxy-3-methyl-2,3-dihydroinden-1-one is sourced from PubChem (CID 605781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).