C11H13NO4 — CID 91622426
3-amino-6,7-dimethoxy-2,3-dihydrochromen-4-one (PubChem CID 91622426) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is 3-amino-6,7-dimethoxy-2,3-dihydrochromen-4-one.
| Compound Name | 3-amino-6,7-dimethoxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 91622426 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 3-amino-6,7-dimethoxy-2,3-dihydrochromen-4-one |
| SMILES | COc1cc2c(cc1OC)C(=O)C(N)CO2 |
| InChI | InChI=1S/C11H13NO4/c1-14-9-3-6-8(4-10(9)15-2)16-5-7(12)11(6)13/h3-4,7H,5,12H2,1-2H3 |
| InChIKey | HAPNKXCGDNEERQ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |