C9H12N2O2 — CID 55294789
6-methoxy-2,3-dihydro-1-benzofuran-3,5-diamine (PubChem CID 55294789) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 6-methoxy-2,3-dihydro-1-benzofuran-3,5-diamine.
| Compound Name | 6-methoxy-2,3-dihydro-1-benzofuran-3,5-diamine |
|---|---|
| PubChem CID | 55294789 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 6-methoxy-2,3-dihydro-1-benzofuran-3,5-diamine |
| SMILES | COc1cc2c(cc1N)C(N)CO2 |
| InChI | InChI=1S/C9H12N2O2/c1-12-9-3-8-5(2-6(9)10)7(11)4-13-8/h2-3,7H,4,10-11H2,1H3 |
| InChIKey | XHBJCWJDTKSSDU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|